C2F6N2O6S2 — CID 165344300
1,1,1-trifluoro-N-nitro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 165344300) has the molecular formula C2F6N2O6S2 and a molecular weight of 326.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-nitro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-nitro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 165344300 |
| Molecular Formula | C2F6N2O6S2 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 1,1,1-trifluoro-N-nitro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | O=[N+]([O-])N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2F6N2O6S2/c3-1(4,5)17(13,14)10(9(11)12)18(15,16)2(6,7)8 |
| InChIKey | LJGVUDDUXYGYLN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|