About sodium;sulfuric acid;nitrate
sodium;sulfuric acid;nitrate (PubChem CID 131742416) has the molecular formula H2NNaO7S
and a molecular weight of 183.07 g/mol. Its IUPAC name is sodium;sulfuric acid;nitrate.
Molecular Properties
| Compound Name | sodium;sulfuric acid;nitrate |
| PubChem CID | 131742416 |
| Molecular Formula | H2NNaO7S |
| Molecular Weight | 183.07 g/mol |
| Exact Mass | 182.94 |
| IUPAC Name | sodium;sulfuric acid;nitrate |
| SMILES | O=S(=O)(O)O.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/NO3.Na.H2O4S/c2-1(3)4;;1-5(2,3)4/h;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | RLFBMFBORXBCQC-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.07 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;sulfuric acid;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;sulfuric acid;nitrate?
The IUPAC name of sodium;sulfuric acid;nitrate (CID 131742416) is sodium;sulfuric acid;nitrate.
What is the SMILES notation for sodium;sulfuric acid;nitrate?
The canonical SMILES for sodium;sulfuric acid;nitrate is O=S(=O)(O)O.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;sulfuric acid;nitrate?
The InChIKey is RLFBMFBORXBCQC-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.Na.H2O4S/c2-1(3)4;;1-5(2,3)4/h;;(H2,1,2,3,4)/q-1;+1;.
What are the key properties of sodium;sulfuric acid;nitrate?
sodium;sulfuric acid;nitrate has a molecular weight of 183.07 g/mol, XLogP of -3.89, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;sulfuric acid;nitrate is sourced from PubChem (CID 131742416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).