About potassium;sulfuric acid;nitrate
potassium;sulfuric acid;nitrate (PubChem CID 23434685) has the molecular formula H2KNO7S
and a molecular weight of 199.18 g/mol. Its IUPAC name is potassium;sulfuric acid;nitrate.
Molecular Properties
| Compound Name | potassium;sulfuric acid;nitrate |
| PubChem CID | 23434685 |
| Molecular Formula | H2KNO7S |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 198.92 |
| IUPAC Name | potassium;sulfuric acid;nitrate |
| SMILES | O=S(=O)(O)O.O=[N+]([O-])[O-].[K+] |
| InChI | InChI=1S/K.NO3.H2O4S/c;2-1(3)4;1-5(2,3)4/h;;(H2,1,2,3,4)/q+1;-1; |
| InChIKey | RIDYGARTUIQVAD-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;sulfuric acid;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sulfuric acid;nitrate?
The IUPAC name of potassium;sulfuric acid;nitrate (CID 23434685) is potassium;sulfuric acid;nitrate.
What is the SMILES notation for potassium;sulfuric acid;nitrate?
The canonical SMILES for potassium;sulfuric acid;nitrate is O=S(=O)(O)O.O=[N+]([O-])[O-].[K+].
What is the InChIKey of potassium;sulfuric acid;nitrate?
The InChIKey is RIDYGARTUIQVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/K.NO3.H2O4S/c;2-1(3)4;1-5(2,3)4/h;;(H2,1,2,3,4)/q+1;-1;.
What are the key properties of potassium;sulfuric acid;nitrate?
potassium;sulfuric acid;nitrate has a molecular weight of 199.18 g/mol, XLogP of -3.89, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sulfuric acid;nitrate is sourced from PubChem (CID 23434685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).