About potassium;sulfuryl dichloride;nitrate
potassium;sulfuryl dichloride;nitrate (PubChem CID 172693068) has the molecular formula Cl2KNO5S
and a molecular weight of 236.07 g/mol. Its IUPAC name is potassium;sulfuryl dichloride;nitrate.
Molecular Properties
| Compound Name | potassium;sulfuryl dichloride;nitrate |
| PubChem CID | 172693068 |
| Molecular Formula | Cl2KNO5S |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 234.85 |
| IUPAC Name | potassium;sulfuryl dichloride;nitrate |
| SMILES | O=S(=O)(Cl)Cl.O=[N+]([O-])[O-].[K+] |
| InChI | InChI=1S/Cl2O2S.K.NO3/c1-5(2,3)4;;2-1(3)4/q;+1;-1 |
| InChIKey | BYEAHVSISMTLNH-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;sulfuryl dichloride;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;sulfuryl dichloride;nitrate?
The IUPAC name of potassium;sulfuryl dichloride;nitrate (CID 172693068) is potassium;sulfuryl dichloride;nitrate.
What is the SMILES notation for potassium;sulfuryl dichloride;nitrate?
The canonical SMILES for potassium;sulfuryl dichloride;nitrate is O=S(=O)(Cl)Cl.O=[N+]([O-])[O-].[K+].
What is the InChIKey of potassium;sulfuryl dichloride;nitrate?
The InChIKey is BYEAHVSISMTLNH-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2O2S.K.NO3/c1-5(2,3)4;;2-1(3)4/q;+1;-1.
What are the key properties of potassium;sulfuryl dichloride;nitrate?
potassium;sulfuryl dichloride;nitrate has a molecular weight of 236.07 g/mol, XLogP of -2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;sulfuryl dichloride;nitrate is sourced from PubChem (CID 172693068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).