About beryllium dinitrate
beryllium dinitrate (PubChem CID 26126) has the molecular formula BeN2O6
and a molecular weight of 133.02 g/mol. Its IUPAC name is beryllium dinitrate.
Molecular Properties
| Compound Name | beryllium dinitrate |
| PubChem CID | 26126 |
| Molecular Formula | BeN2O6 |
| Molecular Weight | 133.02 g/mol |
| Exact Mass | 132.99 |
| IUPAC Name | beryllium dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Be+2] |
| InChI | InChI=1S/Be.2NO3/c;2*2-1(3)4/q+2;2*-1 |
| InChIKey | RFVVBBUVWAIIBT-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 132.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.02 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze beryllium dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium dinitrate?
The IUPAC name of beryllium dinitrate (CID 26126) is beryllium dinitrate.
What is the SMILES notation for beryllium dinitrate?
The canonical SMILES for beryllium dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Be+2].
What is the InChIKey of beryllium dinitrate?
The InChIKey is RFVVBBUVWAIIBT-UHFFFAOYSA-N. The full InChI is InChI=1S/Be.2NO3/c;2*2-1(3)4/q+2;2*-1.
What are the key properties of beryllium dinitrate?
beryllium dinitrate has a molecular weight of 133.02 g/mol, XLogP of -0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium dinitrate is sourced from PubChem (CID 26126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).