About zinc dinitrate
zinc dinitrate (PubChem CID 24518) has the molecular formula N2O6Zn
and a molecular weight of 189.40 g/mol. Its IUPAC name is zinc dinitrate.
Molecular Properties
| Compound Name | zinc dinitrate |
| PubChem CID | 24518 |
| Molecular Formula | N2O6Zn |
| Molecular Weight | 189.40 g/mol |
| Exact Mass | 187.90 |
| IUPAC Name | zinc dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zn+2] |
| InChI | InChI=1S/2NO3.Zn/c2*2-1(3)4;/q2*-1;+2 |
| InChIKey | ONDPHDOFVYQSGI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 132.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.40 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc dinitrate?
The IUPAC name of zinc dinitrate (CID 24518) is zinc dinitrate.
What is the SMILES notation for zinc dinitrate?
The canonical SMILES for zinc dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Zn+2].
What is the InChIKey of zinc dinitrate?
The InChIKey is ONDPHDOFVYQSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/2NO3.Zn/c2*2-1(3)4;/q2*-1;+2.
What are the key properties of zinc dinitrate?
zinc dinitrate has a molecular weight of 189.40 g/mol, XLogP of -0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc dinitrate is sourced from PubChem (CID 24518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).