palladium(2+) nitrate

NO3Pd+ — CID 15793330

IUPACpalladium(2+) nitrate
SMILESO=[N+]([O-])[O-].[Pd+2]
InChIInChI=1S/NO3.Pd/c2-1(3)4;/q-1;+2
InChIKeyHGTFWPAMGOTVDK-UHFFFAOYSA-N
MW168.42 g/mol
LogP-0.24
Rot. Bonds

About palladium(2+) nitrate

palladium(2+) nitrate (PubChem CID 15793330) has the molecular formula NO3Pd+ and a molecular weight of 168.42 g/mol. Its IUPAC name is palladium(2+) nitrate.

Molecular Properties

Compound Namepalladium(2+) nitrate
PubChem CID15793330
Molecular FormulaNO3Pd+
Molecular Weight168.42 g/mol
Exact Mass167.89
IUPAC Namepalladium(2+) nitrate
SMILESO=[N+]([O-])[O-].[Pd+2]
InChIInChI=1S/NO3.Pd/c2-1(3)4;/q-1;+2
InChIKeyHGTFWPAMGOTVDK-UHFFFAOYSA-N
XLogP-0.24
TPSA66.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.42
LogP ≤ 5-0.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze palladium(2+) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of palladium(2+) nitrate?
The IUPAC name of palladium(2+) nitrate (CID 15793330) is palladium(2+) nitrate.
What is the SMILES notation for palladium(2+) nitrate?
The canonical SMILES for palladium(2+) nitrate is O=[N+]([O-])[O-].[Pd+2].
What is the InChIKey of palladium(2+) nitrate?
The InChIKey is HGTFWPAMGOTVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.Pd/c2-1(3)4;/q-1;+2.
What are the key properties of palladium(2+) nitrate?
palladium(2+) nitrate has a molecular weight of 168.42 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+) nitrate is sourced from PubChem (CID 15793330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).