About silver;ethane-1,2-diol;nitrate
silver;ethane-1,2-diol;nitrate (PubChem CID 87126324) has the molecular formula C2H6AgNO5
and a molecular weight of 231.94 g/mol. Its IUPAC name is silver;ethane-1,2-diol;nitrate.
Molecular Properties
| Compound Name | silver;ethane-1,2-diol;nitrate |
| PubChem CID | 87126324 |
| Molecular Formula | C2H6AgNO5 |
| Molecular Weight | 231.94 g/mol |
| Exact Mass | 230.93 |
| IUPAC Name | silver;ethane-1,2-diol;nitrate |
| SMILES | O=[N+]([O-])[O-].OCCO.[Ag+] |
| InChI | InChI=1S/C2H6O2.Ag.NO3/c3-1-2-4;;2-1(3)4/h3-4H,1-2H2;;/q;+1;-1 |
| InChIKey | UGWRVHSFESMVND-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.94 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver;ethane-1,2-diol;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;ethane-1,2-diol;nitrate?
The IUPAC name of silver;ethane-1,2-diol;nitrate (CID 87126324) is silver;ethane-1,2-diol;nitrate.
What is the SMILES notation for silver;ethane-1,2-diol;nitrate?
The canonical SMILES for silver;ethane-1,2-diol;nitrate is O=[N+]([O-])[O-].OCCO.[Ag+].
What is the InChIKey of silver;ethane-1,2-diol;nitrate?
The InChIKey is UGWRVHSFESMVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O2.Ag.NO3/c3-1-2-4;;2-1(3)4/h3-4H,1-2H2;;/q;+1;-1.
What are the key properties of silver;ethane-1,2-diol;nitrate?
silver;ethane-1,2-diol;nitrate has a molecular weight of 231.94 g/mol, XLogP of -1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for silver;ethane-1,2-diol;nitrate is sourced from PubChem (CID 87126324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).