About sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate
sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate (PubChem CID 159119713) has the molecular formula C6H15N2NaO6
and a molecular weight of 234.18 g/mol. Its IUPAC name is sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate.
Molecular Properties
| Compound Name | sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate |
| PubChem CID | 159119713 |
| Molecular Formula | C6H15N2NaO6 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate |
| SMILES | O=[N+]([O-])[O-].OCCN(CCO)CCO.[Na+] |
| InChI | InChI=1S/C6H15NO3.NO3.Na/c8-4-1-7(2-5-9)3-6-10;2-1(3)4;/h8-10H,1-6H2;;/q;-1;+1 |
| InChIKey | KFNPKMUFIAXKPE-UHFFFAOYSA-N |
| XLogP | -4.97 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate?
The IUPAC name of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate (CID 159119713) is sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate.
What is the SMILES notation for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate?
The canonical SMILES for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate is O=[N+]([O-])[O-].OCCN(CCO)CCO.[Na+].
What is the InChIKey of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate?
The InChIKey is KFNPKMUFIAXKPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.NO3.Na/c8-4-1-7(2-5-9)3-6-10;2-1(3)4;/h8-10H,1-6H2;;/q;-1;+1.
What are the key properties of sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate?
sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate has a molecular weight of 234.18 g/mol, XLogP of -4.97, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[bis(2-hydroxyethyl)amino]ethanol;nitrate is sourced from PubChem (CID 159119713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).