N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride

C2F7NO6S3 — CID 142567075

IUPACN,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride
SMILESO=S(=O)(F)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C2F7NO6S3/c3-1(4,5)17(11,12)10(19(9,15)16)18(13,14)2(6,7)8
InChIKeyFQUMCUVQIOGWQW-UHFFFAOYSA-N
MW363.21 g/mol
LogP0.20
Rot. Bonds3

About N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride

N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 142567075) has the molecular formula C2F7NO6S3 and a molecular weight of 363.21 g/mol. Its IUPAC name is N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride.

Molecular Properties

Compound NameN,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride
PubChem CID142567075
Molecular FormulaC2F7NO6S3
Molecular Weight363.21 g/mol
Exact Mass362.88
IUPAC NameN,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride
SMILESO=S(=O)(F)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C2F7NO6S3/c3-1(4,5)17(11,12)10(19(9,15)16)18(13,14)2(6,7)8
InChIKeyFQUMCUVQIOGWQW-UHFFFAOYSA-N
XLogP0.20
TPSA105.66 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.21
LogP ≤ 50.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride?
The IUPAC name of N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride (CID 142567075) is N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride.
What is the SMILES notation for N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride?
The canonical SMILES for N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride is O=S(=O)(F)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride?
The InChIKey is FQUMCUVQIOGWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F7NO6S3/c3-1(4,5)17(11,12)10(19(9,15)16)18(13,14)2(6,7)8.
What are the key properties of N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride?
N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride has a molecular weight of 363.21 g/mol, XLogP of 0.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride is sourced from PubChem (CID 142567075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).