C2F7NO6S3 — CID 142567075
N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 142567075) has the molecular formula C2F7NO6S3 and a molecular weight of 363.21 g/mol. Its IUPAC name is N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride.
| Compound Name | N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 142567075 |
| Molecular Formula | C2F7NO6S3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.88 |
| IUPAC Name | N,N-bis(trifluoromethylsulfonyl)sulfamoyl fluoride |
| SMILES | O=S(=O)(F)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2F7NO6S3/c3-1(4,5)17(11,12)10(19(9,15)16)18(13,14)2(6,7)8 |
| InChIKey | FQUMCUVQIOGWQW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |