C5H8F6N2O5S2 — CID 126606287
1,1,1-trifluoro-N-[2-(hydroxyamino)propan-2-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 126606287) has the molecular formula C5H8F6N2O5S2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-(hydroxyamino)propan-2-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-(hydroxyamino)propan-2-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 126606287 |
| Molecular Formula | C5H8F6N2O5S2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-(hydroxyamino)propan-2-yl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CC(C)(NO)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H8F6N2O5S2/c1-3(2,12-14)13(19(15,16)4(6,7)8)20(17,18)5(9,10)11/h12,14H,1-2H3 |
| InChIKey | NZGXOTXHIONEKN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|