C5H10F3NO4S — CID 139379245
[2-(hydroxyamino)-2-methylpropyl] trifluoromethanesulfonate (PubChem CID 139379245) has the molecular formula C5H10F3NO4S and a molecular weight of 237.20 g/mol. Its IUPAC name is [2-(hydroxyamino)-2-methylpropyl] trifluoromethanesulfonate.
| Compound Name | [2-(hydroxyamino)-2-methylpropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139379245 |
| Molecular Formula | C5H10F3NO4S |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | [2-(hydroxyamino)-2-methylpropyl] trifluoromethanesulfonate |
| SMILES | CC(C)(COS(=O)(=O)C(F)(F)F)NO |
| InChI | InChI=1S/C5H10F3NO4S/c1-4(2,9-10)3-13-14(11,12)5(6,7)8/h9-10H,3H2,1-2H3 |
| InChIKey | URPJFNPTIOORLY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|