C8H4F14O6S2 — CID 88941026
[2,2,3,3,4,4,5,5-octafluoro-6-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate (PubChem CID 88941026) has the molecular formula C8H4F14O6S2 and a molecular weight of 526.22 g/mol. Its IUPAC name is [2,2,3,3,4,4,5,5-octafluoro-6-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate.
| Compound Name | [2,2,3,3,4,4,5,5-octafluoro-6-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88941026 |
| Molecular Formula | C8H4F14O6S2 |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 525.92 |
| IUPAC Name | [2,2,3,3,4,4,5,5-octafluoro-6-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F14O6S2/c9-3(10,1-27-29(23,24)7(17,18)19)5(13,14)6(15,16)4(11,12)2-28-30(25,26)8(20,21)22/h1-2H2 |
| InChIKey | UYOMDWJEZJHVBS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|