C7H11F5O3S — CID 139022830
(2,3-difluoro-2,3-dimethylbutyl) trifluoromethanesulfonate (PubChem CID 139022830) has the molecular formula C7H11F5O3S and a molecular weight of 270.22 g/mol. Its IUPAC name is (2,3-difluoro-2,3-dimethylbutyl) trifluoromethanesulfonate.
| Compound Name | (2,3-difluoro-2,3-dimethylbutyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139022830 |
| Molecular Formula | C7H11F5O3S |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2,3-difluoro-2,3-dimethylbutyl) trifluoromethanesulfonate |
| SMILES | CC(C)(F)C(C)(F)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F5O3S/c1-5(2,8)6(3,9)4-15-16(13,14)7(10,11)12/h4H2,1-3H3 |
| InChIKey | CAFUNDPONPMYSK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|