C5H3F9O4S — CID 23236832
[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] trifluoromethanesulfonate (PubChem CID 23236832) has the molecular formula C5H3F9O4S and a molecular weight of 330.12 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] trifluoromethanesulfonate.
| Compound Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23236832 |
| Molecular Formula | C5H3F9O4S |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | [3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(O)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O4S/c6-3(7,8)2(15,4(9,10)11)1-18-19(16,17)5(12,13)14/h15H,1H2 |
| InChIKey | RYURXGWSDZNNCI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|