C19H39F7O6SSi2 — CID 159875483
3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol;[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate (PubChem CID 159875483) has the molecular formula C19H39F7O6SSi2 and a molecular weight of 584.74 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol;[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol;[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159875483 |
| Molecular Formula | C19H39F7O6SSi2 |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol;[3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)CO.CC(C)(C)[Si](C)(C)OCC(F)(F)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H19F5O4SSi.C9H20F2O2Si/c1-8(2,3)21(4,5)19-7-9(11,12)6-18-20(16,17)10(13,14)15;1-8(2,3)14(4,5)13-7-9(10,11)6-12/h6-7H2,1-5H3;12H,6-7H2,1-5H3 |
| InChIKey | NSVTVQLWJVGNQS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|