C9H7F17O9S3 — CID 161150206
2,2,3,3-tetrafluoropropan-1-ol;2,2,3,3-tetrafluoropropyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 161150206) has the molecular formula C9H7F17O9S3 and a molecular weight of 678.31 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropan-1-ol;2,2,3,3-tetrafluoropropyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | 2,2,3,3-tetrafluoropropan-1-ol;2,2,3,3-tetrafluoropropyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 161150206 |
| Molecular Formula | C9H7F17O9S3 |
| Molecular Weight | 678.31 g/mol |
| Exact Mass | 677.90 |
| IUPAC Name | 2,2,3,3-tetrafluoropropan-1-ol;2,2,3,3-tetrafluoropropyl trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)C(F)F)C(F)(F)F.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.OCC(F)(F)C(F)F |
| InChI | InChI=1S/C4H3F7O3S.C3H4F4O.C2F6O5S2/c5-2(6)3(7,8)1-14-15(12,13)4(9,10)11;4-2(5)3(6,7)1-8;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2H,1H2;2,8H,1H2; |
| InChIKey | UOOQQGSKBCWJGA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|