C5H7F7O2 — CID 160575602
2,2,3,3-tetrafluoropropan-1-ol;2,2,2-trifluoroethanol (PubChem CID 160575602) has the molecular formula C5H7F7O2 and a molecular weight of 232.09 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropan-1-ol;2,2,2-trifluoroethanol.
| Compound Name | 2,2,3,3-tetrafluoropropan-1-ol;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 160575602 |
| Molecular Formula | C5H7F7O2 |
| Molecular Weight | 232.09 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2,2,3,3-tetrafluoropropan-1-ol;2,2,2-trifluoroethanol |
| SMILES | OCC(F)(F)C(F)F.OCC(F)(F)F |
| InChI | InChI=1S/C3H4F4O.C2H3F3O/c4-2(5)3(6,7)1-8;3-2(4,5)1-6/h2,8H,1H2;6H,1H2 |
| InChIKey | RBCLFSBZDMKOPK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.09 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|