C5H4F10 — CID 157410254
1,1,1,2,2-pentafluoroethane;1,1,2,2,3-pentafluoropropane (PubChem CID 157410254) has the molecular formula C5H4F10 and a molecular weight of 254.07 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoroethane;1,1,2,2,3-pentafluoropropane.
| Compound Name | 1,1,1,2,2-pentafluoroethane;1,1,2,2,3-pentafluoropropane |
|---|---|
| PubChem CID | 157410254 |
| Molecular Formula | C5H4F10 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 1,1,1,2,2-pentafluoroethane;1,1,2,2,3-pentafluoropropane |
| SMILES | FC(F)C(F)(F)F.FCC(F)(F)C(F)F |
| InChI | InChI=1S/C3H3F5.C2HF5/c4-1-3(7,8)2(5)6;3-1(4)2(5,6)7/h2H,1H2;1H |
| InChIKey | BOESGIKHQHJLFV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|