C3H3BrF4O3S — CID 151869532
3-bromosulfonyloxy-1,1,2,2-tetrafluoropropane (PubChem CID 151869532) has the molecular formula C3H3BrF4O3S and a molecular weight of 275.02 g/mol. Its IUPAC name is 3-bromosulfonyloxy-1,1,2,2-tetrafluoropropane.
| Compound Name | 3-bromosulfonyloxy-1,1,2,2-tetrafluoropropane |
|---|---|
| PubChem CID | 151869532 |
| Molecular Formula | C3H3BrF4O3S |
| Molecular Weight | 275.02 g/mol |
| Exact Mass | 273.89 |
| IUPAC Name | 3-bromosulfonyloxy-1,1,2,2-tetrafluoropropane |
| SMILES | O=S(=O)(Br)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C3H3BrF4O3S/c4-12(9,10)11-1-3(7,8)2(5)6/h2H,1H2 |
| InChIKey | SMJUWDLJUUDBFA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.02 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|