C6H6ClF8O2P — CID 13115958
chloro-bis(2,2,3,3-tetrafluoropropoxy)phosphane (PubChem CID 13115958) has the molecular formula C6H6ClF8O2P and a molecular weight of 328.52 g/mol. Its IUPAC name is chloro-bis(2,2,3,3-tetrafluoropropoxy)phosphane.
| Compound Name | chloro-bis(2,2,3,3-tetrafluoropropoxy)phosphane |
|---|---|
| PubChem CID | 13115958 |
| Molecular Formula | C6H6ClF8O2P |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | chloro-bis(2,2,3,3-tetrafluoropropoxy)phosphane |
| SMILES | FC(F)C(F)(F)COP(Cl)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6ClF8O2P/c7-18(16-1-5(12,13)3(8)9)17-2-6(14,15)4(10)11/h3-4H,1-2H2 |
| InChIKey | DPQFFCWVMMTXPR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|