C9H6BrClF4O — CID 176513372
2-bromo-1-chloro-3-(2,2,3,3-tetrafluoropropoxy)benzene (PubChem CID 176513372) has the molecular formula C9H6BrClF4O and a molecular weight of 321.50 g/mol. Its IUPAC name is 2-bromo-1-chloro-3-(2,2,3,3-tetrafluoropropoxy)benzene.
| Compound Name | 2-bromo-1-chloro-3-(2,2,3,3-tetrafluoropropoxy)benzene |
|---|---|
| PubChem CID | 176513372 |
| Molecular Formula | C9H6BrClF4O |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 2-bromo-1-chloro-3-(2,2,3,3-tetrafluoropropoxy)benzene |
| SMILES | FC(F)C(F)(F)COc1cccc(Cl)c1Br |
| InChI | InChI=1S/C9H6BrClF4O/c10-7-5(11)2-1-3-6(7)16-4-9(14,15)8(12)13/h1-3,8H,4H2 |
| InChIKey | YVJOZJBJQMUJPQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|