C10H9BrF4N2O2 — CID 114883471
2-bromo-N'-hydroxy-6-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide (PubChem CID 114883471) has the molecular formula C10H9BrF4N2O2 and a molecular weight of 345.09 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-6-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-6-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 114883471 |
| Molecular Formula | C10H9BrF4N2O2 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-bromo-N'-hydroxy-6-(2,2,3,3-tetrafluoropropoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Br)cccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H9BrF4N2O2/c11-5-2-1-3-6(7(5)8(16)17-18)19-4-10(14,15)9(12)13/h1-3,9,18H,4H2,(H2,16,17) |
| InChIKey | NXVCXMXKXXRCMY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|