C9H8ClF3N2O2 — CID 55079423
2-chloro-N'-hydroxy-6-(2,2,2-trifluoroethoxy)benzenecarboximidamide (PubChem CID 55079423) has the molecular formula C9H8ClF3N2O2 and a molecular weight of 268.62 g/mol. Its IUPAC name is 2-chloro-N'-hydroxy-6-(2,2,2-trifluoroethoxy)benzenecarboximidamide.
| Compound Name | 2-chloro-N'-hydroxy-6-(2,2,2-trifluoroethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 55079423 |
| Molecular Formula | C9H8ClF3N2O2 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-chloro-N'-hydroxy-6-(2,2,2-trifluoroethoxy)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1c(Cl)cccc1OCC(F)(F)F |
| InChI | InChI=1S/C9H8ClF3N2O2/c10-5-2-1-3-6(7(5)8(14)15-16)17-4-9(11,12)13/h1-3,16H,4H2,(H2,14,15) |
| InChIKey | RIEPAFTWCXHYPH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|