C10H8F4O2 — CID 21071395
2-(2,2,3,3-tetrafluoropropoxy)benzaldehyde (PubChem CID 21071395) has the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)benzaldehyde.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)benzaldehyde |
|---|---|
| PubChem CID | 21071395 |
| Molecular Formula | C10H8F4O2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)benzaldehyde |
| SMILES | O=Cc1ccccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H8F4O2/c11-9(12)10(13,14)6-16-8-4-2-1-3-7(8)5-15/h1-5,9H,6H2 |
| InChIKey | HHXXZBWLDIJLHX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|