C6H6F8O3PS- — CID 3769735
oxido-sulfanylidene-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane (PubChem CID 3769735) has the molecular formula C6H6F8O3PS- and a molecular weight of 341.14 g/mol. Its IUPAC name is oxido-sulfanylidene-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane.
| Compound Name | oxido-sulfanylidene-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 3769735 |
| Molecular Formula | C6H6F8O3PS- |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | oxido-sulfanylidene-bis(2,2,3,3-tetrafluoropropoxy)-λ5-phosphane |
| SMILES | [O-]P(=S)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H7F8O3PS/c7-3(8)5(11,12)1-16-18(15,19)17-2-6(13,14)4(9)10/h3-4H,1-2H2,(H,15,19)/p-1 |
| InChIKey | DXOBDTYPPHTQLO-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|