C6H6BrF8O4P — CID 130422635
bromo bis(2,2,3,3-tetrafluoropropyl) phosphate (PubChem CID 130422635) has the molecular formula C6H6BrF8O4P and a molecular weight of 404.97 g/mol. Its IUPAC name is bromo bis(2,2,3,3-tetrafluoropropyl) phosphate.
| Compound Name | bromo bis(2,2,3,3-tetrafluoropropyl) phosphate |
|---|---|
| PubChem CID | 130422635 |
| Molecular Formula | C6H6BrF8O4P |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | bromo bis(2,2,3,3-tetrafluoropropyl) phosphate |
| SMILES | O=P(OBr)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6BrF8O4P/c7-19-20(16,17-1-5(12,13)3(8)9)18-2-6(14,15)4(10)11/h3-4H,1-2H2 |
| InChIKey | RCZLHOHVUURNDR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|