C9H8F13O4P — CID 87338363
2,2,3,3,3-pentafluoropropyl bis(2,2,3,3-tetrafluoropropyl) phosphate (PubChem CID 87338363) has the molecular formula C9H8F13O4P and a molecular weight of 458.11 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl bis(2,2,3,3-tetrafluoropropyl) phosphate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl bis(2,2,3,3-tetrafluoropropyl) phosphate |
|---|---|
| PubChem CID | 87338363 |
| Molecular Formula | C9H8F13O4P |
| Molecular Weight | 458.11 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl bis(2,2,3,3-tetrafluoropropyl) phosphate |
| SMILES | O=P(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F13O4P/c10-4(11)6(14,15)1-24-27(23,25-2-7(16,17)5(12)13)26-3-8(18,19)9(20,21)22/h4-5H,1-3H2 |
| InChIKey | AGPWVADYLZQLHB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.11 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|