C9H17F4O4P — CID 88949671
3-(2-diethoxyphosphorylethoxy)-1,1,2,2-tetrafluoropropane (PubChem CID 88949671) has the molecular formula C9H17F4O4P and a molecular weight of 296.20 g/mol. Its IUPAC name is 3-(2-diethoxyphosphorylethoxy)-1,1,2,2-tetrafluoropropane.
| Compound Name | 3-(2-diethoxyphosphorylethoxy)-1,1,2,2-tetrafluoropropane |
|---|---|
| PubChem CID | 88949671 |
| Molecular Formula | C9H17F4O4P |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(2-diethoxyphosphorylethoxy)-1,1,2,2-tetrafluoropropane |
| SMILES | CCOP(=O)(CCOCC(F)(F)C(F)F)OCC |
| InChI | InChI=1S/C9H17F4O4P/c1-3-16-18(14,17-4-2)6-5-15-7-9(12,13)8(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | AWABHWUECRDIKR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|