C10H18F4O3 — CID 55248600
3-(3,3-diethoxypropoxy)-1,1,2,2-tetrafluoropropane (PubChem CID 55248600) has the molecular formula C10H18F4O3 and a molecular weight of 262.24 g/mol. Its IUPAC name is 3-(3,3-diethoxypropoxy)-1,1,2,2-tetrafluoropropane.
| Compound Name | 3-(3,3-diethoxypropoxy)-1,1,2,2-tetrafluoropropane |
|---|---|
| PubChem CID | 55248600 |
| Molecular Formula | C10H18F4O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-(3,3-diethoxypropoxy)-1,1,2,2-tetrafluoropropane |
| SMILES | CCOC(CCOCC(F)(F)C(F)F)OCC |
| InChI | InChI=1S/C10H18F4O3/c1-3-16-8(17-4-2)5-6-15-7-10(13,14)9(11)12/h8-9H,3-7H2,1-2H3 |
| InChIKey | QLBDYCRPEOYSOX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|