C9H14F4O3 — CID 103473882
1-propan-2-yloxy-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473882) has the molecular formula C9H14F4O3 and a molecular weight of 246.20 g/mol. Its IUPAC name is 1-propan-2-yloxy-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-propan-2-yloxy-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473882 |
| Molecular Formula | C9H14F4O3 |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-propan-2-yloxy-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | CC(C)OCC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H14F4O3/c1-6(2)16-4-7(14)3-15-5-9(12,13)8(10)11/h6,8H,3-5H2,1-2H3 |
| InChIKey | LMWPEIYBKRHDKV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|