C13H14F4O2 — CID 103473795
1-(2-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473795) has the molecular formula C13H14F4O2 and a molecular weight of 278.24 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473795 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2-methylphenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | Cc1ccccc1CC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H14F4O2/c1-9-4-2-3-5-10(9)6-11(18)7-19-8-13(16,17)12(14)15/h2-5,12H,6-8H2,1H3 |
| InChIKey | UDGOYBDGDZSNQJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|