C13H14F4O2 — CID 43800999
1-(4-ethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 43800999) has the molecular formula C13H14F4O2 and a molecular weight of 278.25 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-(4-ethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 43800999 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | CCc1ccc(C(=O)COCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C13H14F4O2/c1-2-9-3-5-10(6-4-9)11(18)7-19-8-13(16,17)12(14)15/h3-6,12H,2,7-8H2,1H3 |
| InChIKey | JDJLNYZTHAAAHR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|