C11H12F4N2O2 — CID 103473624
1-(2-amino-3-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473624) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-amino-3-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473624 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | Nc1ncccc1CC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H12F4N2O2/c12-10(13)11(14,15)6-19-5-8(18)4-7-2-1-3-17-9(7)16/h1-3,10H,4-6H2,(H2,16,17) |
| InChIKey | XVFKNMKKAOGGOB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|