C12H16F4N2O — CID 55075103
N-propyl-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine (PubChem CID 55075103) has the molecular formula C12H16F4N2O and a molecular weight of 280.26 g/mol. Its IUPAC name is N-propyl-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine.
| Compound Name | N-propyl-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55075103 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-propyl-3-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine |
| SMILES | CCCNc1ncccc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H16F4N2O/c1-2-5-17-10-9(4-3-6-18-10)7-19-8-12(15,16)11(13)14/h3-4,6,11H,2,5,7-8H2,1H3,(H,17,18) |
| InChIKey | OZEVNQMALWLLRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|