C15H13F4N3O2 — CID 135091161
N-[(2-amino-3-pyridinyl)methyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 135091161) has the molecular formula C15H13F4N3O2 and a molecular weight of 343.28 g/mol. Its IUPAC name is N-[(2-amino-3-pyridinyl)methyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[(2-amino-3-pyridinyl)methyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 135091161 |
| Molecular Formula | C15H13F4N3O2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[(2-amino-3-pyridinyl)methyl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | Nc1ncccc1CNC(=O)c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C15H13F4N3O2/c16-14(17)15(18,19)24-11-6-2-1-5-10(11)13(23)22-8-9-4-3-7-21-12(9)20/h1-7,14H,8H2,(H2,20,21)(H,22,23) |
| InChIKey | IJZBSFVFZUGHIT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|