C14H12F4N2O2S — CID 91830961
2-(1,1,2,2-tetrafluoroethoxy)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide (PubChem CID 91830961) has the molecular formula C14H12F4N2O2S and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-(1,1,2,2-tetrafluoroethoxy)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide.
| Compound Name | 2-(1,1,2,2-tetrafluoroethoxy)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 91830961 |
| Molecular Formula | C14H12F4N2O2S |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-(1,1,2,2-tetrafluoroethoxy)-N-[2-(1,3-thiazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cscn1)c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C14H12F4N2O2S/c15-13(16)14(17,18)22-11-4-2-1-3-10(11)12(21)19-6-5-9-7-23-8-20-9/h1-4,7-8,13H,5-6H2,(H,19,21) |
| InChIKey | ZDAOWOYHZWPUIG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|