C16H14F4N2O2 — CID 87542425
2-amino-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]benzamide (PubChem CID 87542425) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is 2-amino-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]benzamide.
| Compound Name | 2-amino-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87542425 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-amino-N-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]benzamide |
| SMILES | Nc1ccccc1C(=O)NCc1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H14F4N2O2/c17-15(18)16(19,20)24-11-7-5-10(6-8-11)9-22-14(23)12-3-1-2-4-13(12)21/h1-8,15H,9,21H2,(H,22,23) |
| InChIKey | YHOAYXCHMOFZRD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|