C20H29Cl2N3O2 — CID 119946524
2-amino-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]benzamide;dihydrochloride (PubChem CID 119946524) has the molecular formula C20H29Cl2N3O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 2-amino-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119946524 |
| Molecular Formula | C20H29Cl2N3O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-amino-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]benzamide;dihydrochloride |
| SMILES | CCN(CC)CCOc1ccc(CNC(=O)c2ccccc2N)cc1.Cl.Cl |
| InChI | InChI=1S/C20H27N3O2.2ClH/c1-3-23(4-2)13-14-25-17-11-9-16(10-12-17)15-22-20(24)18-7-5-6-8-19(18)21;;/h5-12H,3-4,13-15,21H2,1-2H3,(H,22,24);2*1H |
| InChIKey | XTPPOSNURCQZAO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|