C22H32N4O2 — CID 142171716
2-[amino(methyl)amino]-N-[[4-[3-(diethylamino)propoxy]phenyl]methyl]benzamide (PubChem CID 142171716) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-N-[[4-[3-(diethylamino)propoxy]phenyl]methyl]benzamide.
| Compound Name | 2-[amino(methyl)amino]-N-[[4-[3-(diethylamino)propoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 142171716 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[amino(methyl)amino]-N-[[4-[3-(diethylamino)propoxy]phenyl]methyl]benzamide |
| SMILES | CCN(CC)CCCOc1ccc(CNC(=O)c2ccccc2N(C)N)cc1 |
| InChI | InChI=1S/C22H32N4O2/c1-4-26(5-2)15-8-16-28-19-13-11-18(12-14-19)17-24-22(27)20-9-6-7-10-21(20)25(3)23/h6-7,9-14H,4-5,8,15-17,23H2,1-3H3,(H,24,27) |
| InChIKey | DMFQMVPHVVNAKT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|