C21H31Cl2N3O2 — CID 119848317
2-(4-aminophenyl)-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]acetamide;dihydrochloride (PubChem CID 119848317) has the molecular formula C21H31Cl2N3O2 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119848317 |
| Molecular Formula | C21H31Cl2N3O2 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-(4-aminophenyl)-N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]acetamide;dihydrochloride |
| SMILES | CCN(CC)CCOc1ccc(CNC(=O)Cc2ccc(N)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H29N3O2.2ClH/c1-3-24(4-2)13-14-26-20-11-7-18(8-12-20)16-23-21(25)15-17-5-9-19(22)10-6-17;;/h5-12H,3-4,13-16,22H2,1-2H3,(H,23,25);2*1H |
| InChIKey | JYXVYPAAAOMJMT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|