C21H37ClN2O2 — CID 3026080
2-(diethylamino)-N-[(4-octoxyphenyl)methyl]acetamide;hydrochloride (PubChem CID 3026080) has the molecular formula C21H37ClN2O2 and a molecular weight of 384.99 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(4-octoxyphenyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-(diethylamino)-N-[(4-octoxyphenyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 3026080 |
| Molecular Formula | C21H37ClN2O2 |
| Molecular Weight | 384.99 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-(diethylamino)-N-[(4-octoxyphenyl)methyl]acetamide;hydrochloride |
| SMILES | CCCCCCCCOc1ccc(CNC(=O)CN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C21H36N2O2.ClH/c1-4-7-8-9-10-11-16-25-20-14-12-19(13-15-20)17-22-21(24)18-23(5-2)6-3;/h12-15H,4-11,16-18H2,1-3H3,(H,22,24);1H |
| InChIKey | ZVTVQAOKIPMDJG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|