C12H10BrF5O2 — CID 103473771
1-(2-bromo-3-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one (PubChem CID 103473771) has the molecular formula C12H10BrF5O2 and a molecular weight of 361.10 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
|---|---|
| PubChem CID | 103473771 |
| Molecular Formula | C12H10BrF5O2 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-one |
| SMILES | O=C(COCC(F)(F)C(F)F)Cc1cccc(F)c1Br |
| InChI | InChI=1S/C12H10BrF5O2/c13-10-7(2-1-3-9(10)14)4-8(19)5-20-6-12(17,18)11(15)16/h1-3,11H,4-6H2 |
| InChIKey | BJDNMFBSSVJTBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|