C11H13BrFNO — CID 116553362
5-amino-1-(2-bromo-3-fluorophenyl)pentan-2-one (PubChem CID 116553362) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is 5-amino-1-(2-bromo-3-fluorophenyl)pentan-2-one.
| Compound Name | 5-amino-1-(2-bromo-3-fluorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 116553362 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 5-amino-1-(2-bromo-3-fluorophenyl)pentan-2-one |
| SMILES | NCCCC(=O)Cc1cccc(F)c1Br |
| InChI | InChI=1S/C11H13BrFNO/c12-11-8(3-1-5-10(11)13)7-9(15)4-2-6-14/h1,3,5H,2,4,6-7,14H2 |
| InChIKey | TVPRVHSYHGVGNT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |