C12H15F2NO — CID 114935403
6-amino-1-(2,6-difluorophenyl)hexan-2-one (PubChem CID 114935403) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 6-amino-1-(2,6-difluorophenyl)hexan-2-one.
| Compound Name | 6-amino-1-(2,6-difluorophenyl)hexan-2-one |
|---|---|
| PubChem CID | 114935403 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 6-amino-1-(2,6-difluorophenyl)hexan-2-one |
| SMILES | NCCCCC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2NO/c13-11-5-3-6-12(14)10(11)8-9(16)4-1-2-7-15/h3,5-6H,1-2,4,7-8,15H2 |
| InChIKey | VHBOCBZALZSXSU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|