C14H18F2O2 — CID 103024499
1-(2,6-difluorophenyl)-5-methoxy-5-methylhexan-2-one (PubChem CID 103024499) has the molecular formula C14H18F2O2 and a molecular weight of 256.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-5-methoxy-5-methylhexan-2-one.
| Compound Name | 1-(2,6-difluorophenyl)-5-methoxy-5-methylhexan-2-one |
|---|---|
| PubChem CID | 103024499 |
| Molecular Formula | C14H18F2O2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-5-methoxy-5-methylhexan-2-one |
| SMILES | COC(C)(C)CCC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H18F2O2/c1-14(2,18-3)8-7-10(17)9-11-12(15)5-4-6-13(11)16/h4-6H,7-9H2,1-3H3 |
| InChIKey | GHZZHTHQTQNFOT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |