C8H12F4O4 — CID 63073619
2-ethoxy-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid (PubChem CID 63073619) has the molecular formula C8H12F4O4 and a molecular weight of 248.17 g/mol. Its IUPAC name is 2-ethoxy-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid.
| Compound Name | 2-ethoxy-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid |
|---|---|
| PubChem CID | 63073619 |
| Molecular Formula | C8H12F4O4 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-ethoxy-3-(2,2,3,3-tetrafluoropropoxy)propanoic acid |
| SMILES | CCOC(COCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C8H12F4O4/c1-2-16-5(6(13)14)3-15-4-8(11,12)7(9)10/h5,7H,2-4H2,1H3,(H,13,14) |
| InChIKey | NQPWGLGMJDHOEJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|