C9H18BrF2O4P — CID 87262989
1-(2-bromoethoxy)-3-diethoxyphosphoryl-1,1-difluoropropane (PubChem CID 87262989) has the molecular formula C9H18BrF2O4P and a molecular weight of 339.11 g/mol. Its IUPAC name is 1-(2-bromoethoxy)-3-diethoxyphosphoryl-1,1-difluoropropane.
| Compound Name | 1-(2-bromoethoxy)-3-diethoxyphosphoryl-1,1-difluoropropane |
|---|---|
| PubChem CID | 87262989 |
| Molecular Formula | C9H18BrF2O4P |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1-(2-bromoethoxy)-3-diethoxyphosphoryl-1,1-difluoropropane |
| SMILES | CCOP(=O)(CCC(F)(F)OCCBr)OCC |
| InChI | InChI=1S/C9H18BrF2O4P/c1-3-15-17(13,16-4-2)8-5-9(11,12)14-7-6-10/h3-8H2,1-2H3 |
| InChIKey | SYDSWRVYOSCWSP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|