C7H11F6O3P — CID 12757470
2-diethoxyphosphoryl-1,1,1,3,3,3-hexafluoropropane (PubChem CID 12757470) has the molecular formula C7H11F6O3P and a molecular weight of 288.12 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 2-diethoxyphosphoryl-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 12757470 |
| Molecular Formula | C7H11F6O3P |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-diethoxyphosphoryl-1,1,1,3,3,3-hexafluoropropane |
| SMILES | CCOP(=O)(OCC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F6O3P/c1-3-15-17(14,16-4-2)5(6(8,9)10)7(11,12)13/h5H,3-4H2,1-2H3 |
| InChIKey | BCUYENLMBTVOQU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|