C7H11F4O4P — CID 51350832
3-diethoxyphosphoryl-1,1,1,3-tetrafluoropropan-2-one (PubChem CID 51350832) has the molecular formula C7H11F4O4P and a molecular weight of 266.13 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-1,1,1,3-tetrafluoropropan-2-one.
| Compound Name | 3-diethoxyphosphoryl-1,1,1,3-tetrafluoropropan-2-one |
|---|---|
| PubChem CID | 51350832 |
| Molecular Formula | C7H11F4O4P |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-diethoxyphosphoryl-1,1,1,3-tetrafluoropropan-2-one |
| SMILES | CCOP(=O)(OCC)C(F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F4O4P/c1-3-14-16(13,15-4-2)6(8)5(12)7(9,10)11/h6H,3-4H2,1-2H3 |
| InChIKey | JYBAEAARBMOLHD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|